| Catalog No. | Product Name | Summary | Targets | CAS Number | Smiles |
| A2573 | AEBSF.HCl | Serine protease inhibitor | Serine Protease | 30827-99-7 | C1=CC(=CC=C1CCN)S(=O)(=O)F.Cl |
| A3444 | GS-9620 | TLR-7 agonist | HBV | 1228585-88-3 | CCCCOC1=NC2=C(C(=N1)N)NC(=O)CN2CC3=CC(=CC=C3)CN4CCCC4 |
| A4072 | MK-2048 | Integrase inhibitor for HIV-1,second generation | HIV Integrase | 869901-69-9 | CCN1CC(N2C3=C(C(=C2C1=O)O)C(=O)N(N=C3C(=O)NC)CC4=CC(=C(C=C4)F)Cl)C |
| A8189 | PSI-6206 | Inhibitor of HCV RNA polymerase,potent and selective | HCV Protease | 863329-66-2 | CC1(C(C(OC1N2C=CC(=O)NC2=O)CO)O)F |
| A8458 | Lamivudine | Nucleoside analog reverse transcriptase inhibitor | Reverse Transcriptase | 134678-17-4 | C1C(OC(S1)CO)N2C=CC(=NC2=O)N |
| B1371 | Miltefosine | PI3K/Akt inhibitor | Akt | 58066-85-6 | CCCCCCCCCCCCCCCCOP(=O)([O-])OCC[N+](C)(C)C |
| B1809 | Penciclovir | HSV-1 DNA synthesis inhibitor | Nucleoside Antimetabolite/Analogue | 39809-25-1 | C1=NC2=C(N1CCC(CO)CO)NC(=NC2=O)N |
| B2225 | Stavudine (d4T) | 5-HT6 receptor antagonist, orally active | HIV | 3056-17-5 | CC1=CN(C(=O)NC1=O)C2C=CC(O2)CO |