| Catalog No. | Product Name | Summary | Targets | CAS Number | Smiles |
| A3178 | AN-2728 | PDE4 inhibitor,anti-inflammatory compound | PDE | 906673-24-3 | B1(C2=C(CO1)C=C(C=C2)OC3=CC=C(C=C3)C#N)O |
| A3505 | IRAK-1-4 Inhibitor I | IRAK-1/4 inhibitor | IRAK | 509093-47-4 | C1COCCN1CCN2C3=CC=CC=C3N=C2NC(=O)C4=CC(=CC=C4)[N+](=O)[O-] |
| A3850 | TAK-242 | TLR 4 signaling inhibitor | TLR | 243984-11-4 | CCOC(=O)C1=CCCCC1S(=O)(=O)NC2=C(C=C(C=C2)F)Cl |
| A4328 | Rolipram | PDE4-inhibitor and an anti-inflammatory agent | PDE | 61413-54-5 | COC1=C(C=C(C=C1)C2CC(=O)NC2)OC3CCCC3 |
| A4352 | Anagrelide HCl | Thrombocytopenic agent | PDE | 58579-51-4 | C1C2=C(C=CC(=C2Cl)Cl)NC3=NC(=O)CN31.Cl |
| A8446 | Ibuprofen | inhibitor of cyclooxygenase 1 and cyclooxygenase 2 | COX | 15687-27-1 | CC(C)CC1=CC=C(C=C1)C(C)C(=O)O |
| B1052 | HG-9-91-01 | Pan-SIK (salt-inducible kinases) inhibitor | SIKs | 1456858-58-4 | CC1=C(/N=C(O)/N(C2=NC=NC(NC3=CC=C(N4CCN(CC4)C)C=C3)=C2)C5=C(OC)C=C(OC)C=C5)C(C)=CC=C1 |
| B1444 | Etodolac | COX-2 inhibitor | COX | 41340-25-4 | CCC1=CC=CC2=C1NC3=C2CCOC3(CC)CC(=O)O |